1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride

C9H15ClF2O2S — CID 165495032

IUPAC1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride
SMILESCCC(CC(F)F)CC1(S(=O)(=O)Cl)CC1
InChIInChI=1S/C9H15ClF2O2S/c1-2-7(5-8(11)12)6-9(3-4-9)15(10,13)14/h7-8H,2-6H2,1H3
InChIKeyNWLIBILYOUHILX-UHFFFAOYSA-N
MW260.73 g/mol
LogP3.16
Rot. Bonds6

About 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride

1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride (PubChem CID 165495032) has the molecular formula C9H15ClF2O2S and a molecular weight of 260.73 g/mol. Its IUPAC name is 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride.

Molecular Properties

Compound Name1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride
PubChem CID165495032
Molecular FormulaC9H15ClF2O2S
Molecular Weight260.73 g/mol
Exact Mass260.04
IUPAC Name1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride
SMILESCCC(CC(F)F)CC1(S(=O)(=O)Cl)CC1
InChIInChI=1S/C9H15ClF2O2S/c1-2-7(5-8(11)12)6-9(3-4-9)15(10,13)14/h7-8H,2-6H2,1H3
InChIKeyNWLIBILYOUHILX-UHFFFAOYSA-N
XLogP3.16
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.73
LogP ≤ 53.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride?
The IUPAC name of 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride (CID 165495032) is 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride.
What is the SMILES notation for 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride?
The canonical SMILES for 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride is CCC(CC(F)F)CC1(S(=O)(=O)Cl)CC1.
What is the InChIKey of 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride?
The InChIKey is NWLIBILYOUHILX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClF2O2S/c1-2-7(5-8(11)12)6-9(3-4-9)15(10,13)14/h7-8H,2-6H2,1H3.
What are the key properties of 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride?
1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride has a molecular weight of 260.73 g/mol, XLogP of 3.16, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethyl-4,4-difluorobutyl)cyclopropane-1-sulfonyl chloride is sourced from PubChem (CID 165495032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).