About 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine
5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine (PubChem CID 165495116) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 165495116 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine |
| SMILES | CCCN1CCC=C(C2=CCOCC2)C1 |
| InChI | InChI=1S/C13H21NO/c1-2-7-14-8-3-4-13(11-14)12-5-9-15-10-6-12/h4-5H,2-3,6-11H2,1H3 |
| InChIKey | RVFMFLJYYMCPNI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine (CID 165495116) is 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine is CCCN1CCC=C(C2=CCOCC2)C1.
What is the InChIKey of 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine?
The InChIKey is RVFMFLJYYMCPNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-2-7-14-8-3-4-13(11-14)12-5-9-15-10-6-12/h4-5H,2-3,6-11H2,1H3.
What are the key properties of 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine?
5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine has a molecular weight of 207.32 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,6-dihydro-2H-pyran-4-yl)-1-propyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 165495116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).