C10H15ClN2O2S — CID 165496954
1-[(2-ethyl-5-methylpyrazol-3-yl)methyl]cyclopropane-1-sulfonyl chloride (PubChem CID 165496954) has the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. Its IUPAC name is 1-[(2-ethyl-5-methylpyrazol-3-yl)methyl]cyclopropane-1-sulfonyl chloride.
| Compound Name | 1-[(2-ethyl-5-methylpyrazol-3-yl)methyl]cyclopropane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 165496954 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 1-[(2-ethyl-5-methylpyrazol-3-yl)methyl]cyclopropane-1-sulfonyl chloride |
| SMILES | CCn1nc(C)cc1CC1(S(=O)(=O)Cl)CC1 |
| InChI | InChI=1S/C10H15ClN2O2S/c1-3-13-9(6-8(2)12-13)7-10(4-5-10)16(11,14)15/h6H,3-5,7H2,1-2H3 |
| InChIKey | IAHHNIQUFPQWAP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |