C18H33NO — CID 165497487
3-[cyclopropyl(cyclopropylmethyl)amino]-4-(2-methylbutan-2-yl)cyclohexan-1-ol (PubChem CID 165497487) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 3-[cyclopropyl(cyclopropylmethyl)amino]-4-(2-methylbutan-2-yl)cyclohexan-1-ol.
| Compound Name | 3-[cyclopropyl(cyclopropylmethyl)amino]-4-(2-methylbutan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 165497487 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 3-[cyclopropyl(cyclopropylmethyl)amino]-4-(2-methylbutan-2-yl)cyclohexan-1-ol |
| SMILES | CCC(C)(C)C1CCC(O)CC1N(CC1CC1)C1CC1 |
| InChI | InChI=1S/C18H33NO/c1-4-18(2,3)16-10-9-15(20)11-17(16)19(14-7-8-14)12-13-5-6-13/h13-17,20H,4-12H2,1-3H3 |
| InChIKey | SAKDNZSNQLKVGM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |