About 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol
1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol (PubChem CID 165497640) has the molecular formula C10H14F2O
and a molecular weight of 188.22 g/mol. Its IUPAC name is 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol.
Molecular Properties
| Compound Name | 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol |
| PubChem CID | 165497640 |
| Molecular Formula | C10H14F2O |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol |
| SMILES | OC1(C2CCC2)C=CC(F)(F)CC1 |
| InChI | InChI=1S/C10H14F2O/c11-10(12)6-4-9(13,5-7-10)8-2-1-3-8/h4,6,8,13H,1-3,5,7H2 |
| InChIKey | HNXIDGXSNAURGU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol?
The IUPAC name of 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol (CID 165497640) is 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol.
What is the SMILES notation for 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol?
The canonical SMILES for 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol is OC1(C2CCC2)C=CC(F)(F)CC1.
What is the InChIKey of 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol?
The InChIKey is HNXIDGXSNAURGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2O/c11-10(12)6-4-9(13,5-7-10)8-2-1-3-8/h4,6,8,13H,1-3,5,7H2.
What are the key properties of 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol?
1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol has a molecular weight of 188.22 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-4,4-difluorocyclohex-2-en-1-ol is sourced from PubChem (CID 165497640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).