C9H19N3O2S — CID 165498116
1-(1-imino-1-oxothiolan-3-yl)-1-methyl-3-propan-2-ylurea (PubChem CID 165498116) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-(1-imino-1-oxothiolan-3-yl)-1-methyl-3-propan-2-ylurea.
| Compound Name | 1-(1-imino-1-oxothiolan-3-yl)-1-methyl-3-propan-2-ylurea |
|---|---|
| PubChem CID | 165498116 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(1-imino-1-oxothiolan-3-yl)-1-methyl-3-propan-2-ylurea |
| SMILES | [H]N=S1(=O)CCC(N(C)C(=O)NC(C)C)C1 |
| InChI | InChI=1S/C9H19N3O2S/c1-7(2)11-9(13)12(3)8-4-5-15(10,14)6-8/h7-8,10H,4-6H2,1-3H3,(H,11,13) |
| InChIKey | HLOWPUOJYDJYHP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |