About 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one
2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one (PubChem CID 165498368) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one |
| PubChem CID | 165498368 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one |
| SMILES | Cn1cnn(C2CC(O)CCC2C(C)(C)C)c1=O |
| InChI | InChI=1S/C13H23N3O2/c1-13(2,3)10-6-5-9(17)7-11(10)16-12(18)15(4)8-14-16/h8-11,17H,5-7H2,1-4H3 |
| InChIKey | HXIAMNKBWKSHSI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one?
The IUPAC name of 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one (CID 165498368) is 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one.
What is the SMILES notation for 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one?
The canonical SMILES for 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one is Cn1cnn(C2CC(O)CCC2C(C)(C)C)c1=O.
What is the InChIKey of 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one?
The InChIKey is HXIAMNKBWKSHSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2/c1-13(2,3)10-6-5-9(17)7-11(10)16-12(18)15(4)8-14-16/h8-11,17H,5-7H2,1-4H3.
What are the key properties of 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one?
2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one has a molecular weight of 253.35 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-tert-butyl-5-hydroxycyclohexyl)-4-methyl-1,2,4-triazol-3-one is sourced from PubChem (CID 165498368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).