About 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol
1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol (PubChem CID 165498528) has the molecular formula C12H18F2O
and a molecular weight of 216.27 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol.
Molecular Properties
| Compound Name | 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol |
| PubChem CID | 165498528 |
| Molecular Formula | C12H18F2O |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol |
| SMILES | OC1(CC2CCCC2)C=CC(F)(F)CC1 |
| InChI | InChI=1S/C12H18F2O/c13-12(14)7-5-11(15,6-8-12)9-10-3-1-2-4-10/h5,7,10,15H,1-4,6,8-9H2 |
| InChIKey | OPURLFBBWOJDRI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol?
The IUPAC name of 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol (CID 165498528) is 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol.
What is the SMILES notation for 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol?
The canonical SMILES for 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol is OC1(CC2CCCC2)C=CC(F)(F)CC1.
What is the InChIKey of 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol?
The InChIKey is OPURLFBBWOJDRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2O/c13-12(14)7-5-11(15,6-8-12)9-10-3-1-2-4-10/h5,7,10,15H,1-4,6,8-9H2.
What are the key properties of 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol?
1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol has a molecular weight of 216.27 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopentylmethyl)-4,4-difluorocyclohex-2-en-1-ol is sourced from PubChem (CID 165498528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).