2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride

C9H9ClN2O2S — CID 165499956

IUPAC2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride
SMILESCc1nc2cccc(C)n2c1S(=O)(=O)Cl
InChIInChI=1S/C9H9ClN2O2S/c1-6-4-3-5-8-11-7(2)9(12(6)8)15(10,13)14/h3-5H,1-2H3
InChIKeyFLHUYSFFRODAMJ-UHFFFAOYSA-N
MW244.70 g/mol
LogP1.88
Rot. Bonds1

About 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride

2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride (PubChem CID 165499956) has the molecular formula C9H9ClN2O2S and a molecular weight of 244.70 g/mol. Its IUPAC name is 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride.

Molecular Properties

Compound Name2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride
PubChem CID165499956
Molecular FormulaC9H9ClN2O2S
Molecular Weight244.70 g/mol
Exact Mass244.01
IUPAC Name2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride
SMILESCc1nc2cccc(C)n2c1S(=O)(=O)Cl
InChIInChI=1S/C9H9ClN2O2S/c1-6-4-3-5-8-11-7(2)9(12(6)8)15(10,13)14/h3-5H,1-2H3
InChIKeyFLHUYSFFRODAMJ-UHFFFAOYSA-N
XLogP1.88
TPSA51.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.70
LogP ≤ 51.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The IUPAC name of 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride (CID 165499956) is 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride.
What is the SMILES notation for 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The canonical SMILES for 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride is Cc1nc2cccc(C)n2c1S(=O)(=O)Cl.
What is the InChIKey of 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The InChIKey is FLHUYSFFRODAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O2S/c1-6-4-3-5-8-11-7(2)9(12(6)8)15(10,13)14/h3-5H,1-2H3.
What are the key properties of 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride?
2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride has a molecular weight of 244.70 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride is sourced from PubChem (CID 165499956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).