C27H21ClN2O4S — CID 16552391
5-[benzyl(methyl)sulfamoyl]-2-chloro-N-dibenzofuran-2-ylbenzamide (PubChem CID 16552391) has the molecular formula C27H21ClN2O4S and a molecular weight of 505.00 g/mol. Its IUPAC name is 5-[benzyl(methyl)sulfamoyl]-2-chloro-N-dibenzofuran-2-ylbenzamide.
| Compound Name | 5-[benzyl(methyl)sulfamoyl]-2-chloro-N-dibenzofuran-2-ylbenzamide |
|---|---|
| PubChem CID | 16552391 |
| Molecular Formula | C27H21ClN2O4S |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 5-[benzyl(methyl)sulfamoyl]-2-chloro-N-dibenzofuran-2-ylbenzamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2ccc3oc4ccccc4c3c2)c1 |
| InChI | InChI=1S/C27H21ClN2O4S/c1-30(17-18-7-3-2-4-8-18)35(32,33)20-12-13-24(28)23(16-20)27(31)29-19-11-14-26-22(15-19)21-9-5-6-10-25(21)34-26/h2-16H,17H2,1H3,(H,29,31) |
| InChIKey | LVOABRLTRXTTKQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |