C14H9Cl4NO2 — CID 16552943
(3,5-dimethylphenyl) 3,4,5,6-tetrachloropyridine-2-carboxylate (PubChem CID 16552943) has the molecular formula C14H9Cl4NO2 and a molecular weight of 365.04 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 3,4,5,6-tetrachloropyridine-2-carboxylate.
| Compound Name | (3,5-dimethylphenyl) 3,4,5,6-tetrachloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 16552943 |
| Molecular Formula | C14H9Cl4NO2 |
| Molecular Weight | 365.04 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | (3,5-dimethylphenyl) 3,4,5,6-tetrachloropyridine-2-carboxylate |
| SMILES | Cc1cc(C)cc(OC(=O)c2nc(Cl)c(Cl)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C14H9Cl4NO2/c1-6-3-7(2)5-8(4-6)21-14(20)12-10(16)9(15)11(17)13(18)19-12/h3-5H,1-2H3 |
| InChIKey | GSRXWSNLMMYIMD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.04 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|