C25H18F2N2O2 — CID 16553490
N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-(naphthalen-2-yloxymethyl)benzamide (PubChem CID 16553490) has the molecular formula C25H18F2N2O2 and a molecular weight of 416.43 g/mol. Its IUPAC name is N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-(naphthalen-2-yloxymethyl)benzamide.
| Compound Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-(naphthalen-2-yloxymethyl)benzamide |
|---|---|
| PubChem CID | 16553490 |
| Molecular Formula | C25H18F2N2O2 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-(naphthalen-2-yloxymethyl)benzamide |
| SMILES | O=C(N/N=C/c1ccc(F)c(F)c1)c1ccc(COc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C25H18F2N2O2/c26-23-12-7-18(13-24(23)27)15-28-29-25(30)20-8-5-17(6-9-20)16-31-22-11-10-19-3-1-2-4-21(19)14-22/h1-15H,16H2,(H,29,30)/b28-15+ |
| InChIKey | YCLGPCIQJIYPKL-RWPZCVJISA-N |
| XLogP | 5.46 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|