C17H31N3S — CID 16553969
1-(2-bicyclo[2.2.1]heptanyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 16553969) has the molecular formula C17H31N3S and a molecular weight of 309.52 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 16553969 |
| Molecular Formula | C17H31N3S |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CC1(C)CC(NC(=S)NC2CC3CCC2C3)CC(C)(C)N1 |
| InChI | InChI=1S/C17H31N3S/c1-16(2)9-13(10-17(3,4)20-16)18-15(21)19-14-8-11-5-6-12(14)7-11/h11-14,20H,5-10H2,1-4H3,(H2,18,19,21) |
| InChIKey | LMFZXVRFXAOBQA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|