About 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide
2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide (PubChem CID 16555624) has the molecular formula C19H19N3O3S
and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide.
Molecular Properties
| Compound Name | 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide |
| PubChem CID | 16555624 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide |
| SMILES | COCCn1c(-c2ccc(O)c(C(N)=O)c2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C19H19N3O3S/c1-25-10-9-22-16(13-7-8-17(23)15(11-13)18(20)24)12-26-19(22)21-14-5-3-2-4-6-14/h2-8,11-12,23H,9-10H2,1H3,(H2,20,24)/b21-19- |
| InChIKey | ALWXWZPQIVPVOE-VZCXRCSSSA-N |
| XLogP | 2.90 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide?
The IUPAC name of 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide (CID 16555624) is 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide.
What is the SMILES notation for 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide?
The canonical SMILES for 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide is COCCn1c(-c2ccc(O)c(C(N)=O)c2)cs/c1=N\c1ccccc1.
What is the InChIKey of 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide?
The InChIKey is ALWXWZPQIVPVOE-VZCXRCSSSA-N. The full InChI is InChI=1S/C19H19N3O3S/c1-25-10-9-22-16(13-7-8-17(23)15(11-13)18(20)24)12-26-19(22)21-14-5-3-2-4-6-14/h2-8,11-12,23H,9-10H2,1H3,(H2,20,24)/b21-19-.
What are the key properties of 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide?
2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide has a molecular weight of 369.45 g/mol, XLogP of 2.90, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-[3-(2-methoxyethyl)-2-phenylimino-1,3-thiazol-4-yl]benzamide is sourced from PubChem (CID 16555624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).