About 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile
4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile (PubChem CID 16556457) has the molecular formula C17H13Cl2NO
and a molecular weight of 318.20 g/mol. Its IUPAC name is 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile |
| PubChem CID | 16556457 |
| Molecular Formula | C17H13Cl2NO |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(OCC3CC3(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C17H13Cl2NO/c18-17(19)9-15(17)11-21-16-7-5-14(6-8-16)13-3-1-12(10-20)2-4-13/h1-8,15H,9,11H2 |
| InChIKey | IEOVYVJYXXBAAG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile?
The IUPAC name of 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile (CID 16556457) is 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile.
What is the SMILES notation for 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile?
The canonical SMILES for 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile is N#Cc1ccc(-c2ccc(OCC3CC3(Cl)Cl)cc2)cc1.
What is the InChIKey of 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile?
The InChIKey is IEOVYVJYXXBAAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2NO/c18-17(19)9-15(17)11-21-16-7-5-14(6-8-16)13-3-1-12(10-20)2-4-13/h1-8,15H,9,11H2.
What are the key properties of 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile?
4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile has a molecular weight of 318.20 g/mol, XLogP of 4.80, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2,2-dichlorocyclopropyl)methoxy]phenyl]benzonitrile is sourced from PubChem (CID 16556457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).