About (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate
(2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 16556459) has the molecular formula C19H11Cl3O4
and a molecular weight of 409.65 g/mol. Its IUPAC name is (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate.
Molecular Properties
| Compound Name | (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| PubChem CID | 16556459 |
| Molecular Formula | C19H11Cl3O4 |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C(OCC1CC1(Cl)Cl)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H11Cl3O4/c20-15-13(18(25)26-8-9-7-19(9,21)22)6-5-12-14(15)17(24)11-4-2-1-3-10(11)16(12)23/h1-6,9H,7-8H2 |
| InChIKey | NKFCHXOFNDAZOP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate?
The IUPAC name of (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate (CID 16556459) is (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate.
What is the SMILES notation for (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate?
The canonical SMILES for (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate is O=C(OCC1CC1(Cl)Cl)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O.
What is the InChIKey of (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate?
The InChIKey is NKFCHXOFNDAZOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11Cl3O4/c20-15-13(18(25)26-8-9-7-19(9,21)22)6-5-12-14(15)17(24)11-4-2-1-3-10(11)16(12)23/h1-6,9H,7-8H2.
What are the key properties of (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate?
(2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate has a molecular weight of 409.65 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dichlorocyclopropyl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate is sourced from PubChem (CID 16556459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).