C16H16ClN5OS — CID 16556502
4-amino-3-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-6-methyl-1,2,4-triazin-5-one (PubChem CID 16556502) has the molecular formula C16H16ClN5OS and a molecular weight of 361.86 g/mol. Its IUPAC name is 4-amino-3-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-6-methyl-1,2,4-triazin-5-one.
| Compound Name | 4-amino-3-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-6-methyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 16556502 |
| Molecular Formula | C16H16ClN5OS |
| Molecular Weight | 361.86 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 4-amino-3-[(2-chloro-7,8-dimethylquinolin-3-yl)methylsulfanyl]-6-methyl-1,2,4-triazin-5-one |
| SMILES | Cc1ccc2cc(CSc3nnc(C)c(=O)n3N)c(Cl)nc2c1C |
| InChI | InChI=1S/C16H16ClN5OS/c1-8-4-5-11-6-12(14(17)19-13(11)9(8)2)7-24-16-21-20-10(3)15(23)22(16)18/h4-6H,7,18H2,1-3H3 |
| InChIKey | KSPWEFHPCUJUPS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.86 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|