About 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide
2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 16556940) has the molecular formula C18H16N2O3S
and a molecular weight of 340.40 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 16556940 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | COc1ccc(OC)c(C(=O)Nc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C18H16N2O3S/c1-22-13-8-9-16(23-2)14(10-13)17(21)20-18-19-15(11-24-18)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,19,20,21) |
| InChIKey | XKKPOJVEPMBPJH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (CID 16556940) is 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide is COc1ccc(OC)c(C(=O)Nc2nc(-c3ccccc3)cs2)c1.
What is the InChIKey of 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The InChIKey is XKKPOJVEPMBPJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O3S/c1-22-13-8-9-16(23-2)14(10-13)17(21)20-18-19-15(11-24-18)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,19,20,21).
What are the key properties of 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide has a molecular weight of 340.40 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxy-N-(4-phenyl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 16556940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).