C29H21F3N4O4S2 — CID 16558122
2-[11-(4-methylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 16558122) has the molecular formula C29H21F3N4O4S2 and a molecular weight of 610.64 g/mol. Its IUPAC name is 2-[11-(4-methylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[11-(4-methylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16558122 |
| Molecular Formula | C29H21F3N4O4S2 |
| Molecular Weight | 610.64 g/mol |
| Exact Mass | 610.10 |
| IUPAC Name | 2-[11-(4-methylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4cccc(C(F)(F)F)c4)C(c4cccnc4)C3C2=O)cc1 |
| InChI | InChI=1S/C29H21F3N4O4S2/c1-15-7-9-19(10-8-15)36-25(38)22-21(16-4-3-11-33-13-16)24-27(41-23(22)26(36)39)35(28(40)42-24)14-20(37)34-18-6-2-5-17(12-18)29(30,31)32/h2-13,21-23H,14H2,1H3,(H,34,37) |
| InChIKey | AHNKMWVSWLUWIL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|