About [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 16561325) has the molecular formula C19H14ClFO3S3
and a molecular weight of 440.97 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| PubChem CID | 16561325 |
| Molecular Formula | C19H14ClFO3S3 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | COc1cc(C2SCCS2)ccc1OC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C19H14ClFO3S3/c1-23-14-8-10(19-25-6-7-26-19)2-5-13(14)24-18(22)17-16(20)12-4-3-11(21)9-15(12)27-17/h2-5,8-9,19H,6-7H2,1H3 |
| InChIKey | AAEIAVCKRFDPAQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate?
The IUPAC name of [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (CID 16561325) is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
What is the SMILES notation for [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate?
The canonical SMILES for [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate is COc1cc(C2SCCS2)ccc1OC(=O)c1sc2cc(F)ccc2c1Cl.
What is the InChIKey of [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate?
The InChIKey is AAEIAVCKRFDPAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClFO3S3/c1-23-14-8-10(19-25-6-7-26-19)2-5-13(14)24-18(22)17-16(20)12-4-3-11(21)9-15(12)27-17/h2-5,8-9,19H,6-7H2,1H3.
What are the key properties of [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate?
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate has a molecular weight of 440.97 g/mol, XLogP of 6.40, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 16561325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).