C19H30N4O3 — CID 16561916
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-cyclopent-2-en-1-yl-N-(2-methylpropyl)acetamide (PubChem CID 16561916) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-cyclopent-2-en-1-yl-N-(2-methylpropyl)acetamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-cyclopent-2-en-1-yl-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 16561916 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-cyclopent-2-en-1-yl-N-(2-methylpropyl)acetamide |
| SMILES | CCCCn1c(N)c(N(CC(C)C)C(=O)CC2C=CCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H30N4O3/c1-4-5-10-22-17(20)16(18(25)21-19(22)26)23(12-13(2)3)15(24)11-14-8-6-7-9-14/h6,8,13-14H,4-5,7,9-12,20H2,1-3H3,(H,21,25,26) |
| InChIKey | BXBKUHHLINAROQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|