C15H18ClN3O2S2 — CID 16562326
N-butyl-5-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 16562326) has the molecular formula C15H18ClN3O2S2 and a molecular weight of 371.92 g/mol. Its IUPAC name is N-butyl-5-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-butyl-5-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 16562326 |
| Molecular Formula | C15H18ClN3O2S2 |
| Molecular Weight | 371.92 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-butyl-5-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCNc1nnc(SCc2cc(Cl)c3c(c2)OCCO3)s1 |
| InChI | InChI=1S/C15H18ClN3O2S2/c1-2-3-4-17-14-18-19-15(23-14)22-9-10-7-11(16)13-12(8-10)20-5-6-21-13/h7-8H,2-6,9H2,1H3,(H,17,18) |
| InChIKey | BJBVDNXYAXTGSJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.92 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|