C23H27N3O2S2 — CID 16562361
2-(3-butan-2-yl-4-oxoquinazolin-2-yl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 16562361) has the molecular formula C23H27N3O2S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-(3-butan-2-yl-4-oxoquinazolin-2-yl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-(3-butan-2-yl-4-oxoquinazolin-2-yl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 16562361 |
| Molecular Formula | C23H27N3O2S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-(3-butan-2-yl-4-oxoquinazolin-2-yl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | CCC(C)n1c(SCC(=O)NCCSc2ccc(C)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H27N3O2S2/c1-4-17(3)26-22(28)19-7-5-6-8-20(19)25-23(26)30-15-21(27)24-13-14-29-18-11-9-16(2)10-12-18/h5-12,17H,4,13-15H2,1-3H3,(H,24,27) |
| InChIKey | KLTALRIJSOLTQO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|