C24H21N5OS — CID 16562621
N-[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 16562621) has the molecular formula C24H21N5OS and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 16562621 |
| Molecular Formula | C24H21N5OS |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1ccc(/N=N/c2cc(C)ccc2NC(=O)Cc2csc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C24H21N5OS/c1-16-6-9-18(10-7-16)28-29-22-13-17(2)8-11-20(22)27-23(30)14-19-15-31-24(26-19)21-5-3-4-12-25-21/h3-13,15H,14H2,1-2H3,(H,27,30)/b29-28+ |
| InChIKey | GNCBXCGRGWJRPR-ZQHSETAFSA-N |
| XLogP | 6.42 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|