C19H16F2N2O — CID 16562695
N-(3,4-difluorophenyl)-2-propan-2-ylquinoline-4-carboxamide (PubChem CID 16562695) has the molecular formula C19H16F2N2O and a molecular weight of 326.35 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-propan-2-ylquinoline-4-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-2-propan-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 16562695 |
| Molecular Formula | C19H16F2N2O |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-propan-2-ylquinoline-4-carboxamide |
| SMILES | CC(C)c1cc(C(=O)Nc2ccc(F)c(F)c2)c2ccccc2n1 |
| InChI | InChI=1S/C19H16F2N2O/c1-11(2)18-10-14(13-5-3-4-6-17(13)23-18)19(24)22-12-7-8-15(20)16(21)9-12/h3-11H,1-2H3,(H,22,24) |
| InChIKey | YVHGDQAFOWQCET-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |