C21H26N2O6S2 — CID 16566573
N-[5-(diethylsulfamoyl)-2-phenoxyphenyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 16566573) has the molecular formula C21H26N2O6S2 and a molecular weight of 466.58 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-phenoxyphenyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-phenoxyphenyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 16566573 |
| Molecular Formula | C21H26N2O6S2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-phenoxyphenyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Oc2ccccc2)c(NC(=O)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C21H26N2O6S2/c1-3-23(4-2)31(27,28)18-10-11-20(29-17-8-6-5-7-9-17)19(14-18)22-21(24)16-12-13-30(25,26)15-16/h5-11,14,16H,3-4,12-13,15H2,1-2H3,(H,22,24) |
| InChIKey | RXYNPSUBZTUISS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |