C22H22N6O3S2 — CID 16566791
ethyl 2-[[2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 16566791) has the molecular formula C22H22N6O3S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is ethyl 2-[[2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 16566791 |
| Molecular Formula | C22H22N6O3S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | ethyl 2-[[2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)Cc2c(C)nc3nc(SC)nn3c2C)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H22N6O3S2/c1-5-31-19(30)18-17(14-9-7-6-8-10-14)25-21(33-18)24-16(29)11-15-12(2)23-20-26-22(32-4)27-28(20)13(15)3/h6-10H,5,11H2,1-4H3,(H,24,25,29) |
| InChIKey | QEOGUUZWCFSFJK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |