C21H20INOS — CID 16566983
6-(4-iodophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[c][1,5]benzothiazepin-7-one (PubChem CID 16566983) has the molecular formula C21H20INOS and a molecular weight of 461.37 g/mol. Its IUPAC name is 6-(4-iodophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[c][1,5]benzothiazepin-7-one.
| Compound Name | 6-(4-iodophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[c][1,5]benzothiazepin-7-one |
|---|---|
| PubChem CID | 16566983 |
| Molecular Formula | C21H20INOS |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 6-(4-iodophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[c][1,5]benzothiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1SC2c1ccc(I)cc1 |
| InChI | InChI=1S/C21H20INOS/c1-21(2)11-16-19(17(24)12-21)20(13-7-9-14(22)10-8-13)25-18-6-4-3-5-15(18)23-16/h3-10,20,23H,11-12H2,1-2H3 |
| InChIKey | DKIZJMLUQCPKTO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|