C20H20N2O6S — CID 16567881
phenyl 3-(2-oxo-6-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-3-yl)propanoate (PubChem CID 16567881) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is phenyl 3-(2-oxo-6-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-3-yl)propanoate.
| Compound Name | phenyl 3-(2-oxo-6-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-3-yl)propanoate |
|---|---|
| PubChem CID | 16567881 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | phenyl 3-(2-oxo-6-pyrrolidin-1-ylsulfonyl-1,3-benzoxazol-3-yl)propanoate |
| SMILES | O=C(CCn1c(=O)oc2cc(S(=O)(=O)N3CCCC3)ccc21)Oc1ccccc1 |
| InChI | InChI=1S/C20H20N2O6S/c23-19(27-15-6-2-1-3-7-15)10-13-22-17-9-8-16(14-18(17)28-20(22)24)29(25,26)21-11-4-5-12-21/h1-3,6-9,14H,4-5,10-13H2 |
| InChIKey | RTJFMYXMLIJTRH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 98.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|