About 1-butylsulfinylbutane
1-butylsulfinylbutane (PubChem CID 16568) has the molecular formula C8H18OS
and a molecular weight of 162.30 g/mol. Its IUPAC name is 1-butylsulfinylbutane.
Molecular Properties
| Compound Name | 1-butylsulfinylbutane |
| PubChem CID | 16568 |
| Molecular Formula | C8H18OS |
| Molecular Weight | 162.30 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | 1-butylsulfinylbutane |
| SMILES | CCCCS(=O)CCCC |
| InChI | InChI=1S/C8H18OS/c1-3-5-7-10(9)8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | LOWMYOWHQMKBTM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butylsulfinylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfinylbutane?
The IUPAC name of 1-butylsulfinylbutane (CID 16568) is 1-butylsulfinylbutane.
What is the SMILES notation for 1-butylsulfinylbutane?
The canonical SMILES for 1-butylsulfinylbutane is CCCCS(=O)CCCC.
What is the InChIKey of 1-butylsulfinylbutane?
The InChIKey is LOWMYOWHQMKBTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18OS/c1-3-5-7-10(9)8-6-4-2/h3-8H2,1-2H3.
What are the key properties of 1-butylsulfinylbutane?
1-butylsulfinylbutane has a molecular weight of 162.30 g/mol, XLogP of 2.34, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfinylbutane is sourced from PubChem (CID 16568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).