C19H19FN2O4S — CID 16569064
(2-butoxy-2-oxoethyl) 1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 16569064) has the molecular formula C19H19FN2O4S and a molecular weight of 390.44 g/mol. Its IUPAC name is (2-butoxy-2-oxoethyl) 1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | (2-butoxy-2-oxoethyl) 1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 16569064 |
| Molecular Formula | C19H19FN2O4S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (2-butoxy-2-oxoethyl) 1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | CCCCOC(=O)COC(=O)c1cc2c(C)nn(-c3ccc(F)cc3)c2s1 |
| InChI | InChI=1S/C19H19FN2O4S/c1-3-4-9-25-17(23)11-26-19(24)16-10-15-12(2)21-22(18(15)27-16)14-7-5-13(20)6-8-14/h5-8,10H,3-4,9,11H2,1-2H3 |
| InChIKey | GWVNSWHZBDNNSS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|