C24H17F3N4O5 — CID 16569736
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 16569736) has the molecular formula C24H17F3N4O5 and a molecular weight of 498.42 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16569736 |
| Molecular Formula | C24H17F3N4O5 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C24H17F3N4O5/c25-24(26,27)18-13-17(31(35)36)11-12-19(18)28-20(32)14-30-21(33)23(29-22(30)34,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13H,14H2,(H,28,32)(H,29,34) |
| InChIKey | UVJNUJLVJFZZIY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|