About (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate
(8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 16570118) has the molecular formula C23H22N4O2
and a molecular weight of 386.46 g/mol. Its IUPAC name is (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate.
Molecular Properties
| Compound Name | (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
| PubChem CID | 16570118 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)OCc1cn2cccc(C)c2n1 |
| InChI | InChI=1S/C23H22N4O2/c1-16-8-7-13-26-14-19(24-23(16)26)15-29-22(28)12-11-21-17(2)25-27(18(21)3)20-9-5-4-6-10-20/h4-14H,15H2,1-3H3/b12-11+ |
| InChIKey | JNCGVSJELXRXSE-VAWYXSNFSA-N |
| XLogP | 4.20 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate?
The IUPAC name of (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate (CID 16570118) is (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate.
What is the SMILES notation for (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate?
The canonical SMILES for (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate is Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)OCc1cn2cccc(C)c2n1.
What is the InChIKey of (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate?
The InChIKey is JNCGVSJELXRXSE-VAWYXSNFSA-N. The full InChI is InChI=1S/C23H22N4O2/c1-16-8-7-13-26-14-19(24-23(16)26)15-29-22(28)12-11-21-17(2)25-27(18(21)3)20-9-5-4-6-10-20/h4-14H,15H2,1-3H3/b12-11+.
What are the key properties of (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate?
(8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate has a molecular weight of 386.46 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methylimidazo[1,2-a]pyridin-2-yl)methyl (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate is sourced from PubChem (CID 16570118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).