C27H34N6OS — CID 16571494
N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-[[4-phenyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 16571494) has the molecular formula C27H34N6OS and a molecular weight of 490.68 g/mol. Its IUPAC name is N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-[[4-phenyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-[[4-phenyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16571494 |
| Molecular Formula | C27H34N6OS |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-[[4-phenyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1cc(NC(=O)CSc2nnc(CN3CCCCC3)n2-c2ccccc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C27H34N6OS/c1-21-18-22(12-13-24(21)32-16-8-9-17-32)28-26(34)20-35-27-30-29-25(19-31-14-6-3-7-15-31)33(27)23-10-4-2-5-11-23/h2,4-5,10-13,18H,3,6-9,14-17,19-20H2,1H3,(H,28,34) |
| InChIKey | NCOZUUPGDDHVQP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|