C14H9ClF3N5O — CID 16571776
6-chloro-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]pyridine-3-carboxamide (PubChem CID 16571776) has the molecular formula C14H9ClF3N5O and a molecular weight of 355.71 g/mol. Its IUPAC name is 6-chloro-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16571776 |
| Molecular Formula | C14H9ClF3N5O |
| Molecular Weight | 355.71 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 6-chloro-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1nnc2ccc(C(F)(F)F)cn12)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H9ClF3N5O/c15-10-3-1-8(5-19-10)13(24)20-6-12-22-21-11-4-2-9(7-23(11)12)14(16,17)18/h1-5,7H,6H2,(H,20,24) |
| InChIKey | KVJLPAWTISCOPM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|