About (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate
(2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate (PubChem CID 16572529) has the molecular formula C18H15Cl2NO4
and a molecular weight of 380.23 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate.
Molecular Properties
| Compound Name | (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate |
| PubChem CID | 16572529 |
| Molecular Formula | C18H15Cl2NO4 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate |
| SMILES | CC1Oc2ccccc2N(CCC(=O)Oc2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C18H15Cl2NO4/c1-11-18(23)21(14-4-2-3-5-16(14)24-11)9-8-17(22)25-15-7-6-12(19)10-13(15)20/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | FLOMVYWDEWOXFI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate?
The IUPAC name of (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate (CID 16572529) is (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate.
What is the SMILES notation for (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate?
The canonical SMILES for (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate is CC1Oc2ccccc2N(CCC(=O)Oc2ccc(Cl)cc2Cl)C1=O.
What is the InChIKey of (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate?
The InChIKey is FLOMVYWDEWOXFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Cl2NO4/c1-11-18(23)21(14-4-2-3-5-16(14)24-11)9-8-17(22)25-15-7-6-12(19)10-13(15)20/h2-7,10-11H,8-9H2,1H3.
What are the key properties of (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate?
(2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate has a molecular weight of 380.23 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl) 3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanoate is sourced from PubChem (CID 16572529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).