C17H12FNO3S — CID 16573724
(3-fluorophenyl) 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate (PubChem CID 16573724) has the molecular formula C17H12FNO3S and a molecular weight of 329.35 g/mol. Its IUPAC name is (3-fluorophenyl) 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate.
| Compound Name | (3-fluorophenyl) 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate |
|---|---|
| PubChem CID | 16573724 |
| Molecular Formula | C17H12FNO3S |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (3-fluorophenyl) 1-oxo-2,3-dihydropyrrolo[2,1-b][1,3]benzothiazole-3a-carboxylate |
| SMILES | O=C1CCC2(C(=O)Oc3cccc(F)c3)Sc3ccccc3N12 |
| InChI | InChI=1S/C17H12FNO3S/c18-11-4-3-5-12(10-11)22-16(21)17-9-8-15(20)19(17)13-6-1-2-7-14(13)23-17/h1-7,10H,8-9H2 |
| InChIKey | NFDUPQFRJMKPRT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|