C26H27N5 — CID 16576279
1-[(1,3-diphenylpyrazol-4-yl)methyl]-4-(pyridin-2-ylmethyl)piperazine (PubChem CID 16576279) has the molecular formula C26H27N5 and a molecular weight of 409.54 g/mol. Its IUPAC name is 1-[(1,3-diphenylpyrazol-4-yl)methyl]-4-(pyridin-2-ylmethyl)piperazine.
| Compound Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-4-(pyridin-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 16576279 |
| Molecular Formula | C26H27N5 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-4-(pyridin-2-ylmethyl)piperazine |
| SMILES | c1ccc(-c2nn(-c3ccccc3)cc2CN2CCN(Cc3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C26H27N5/c1-3-9-22(10-4-1)26-23(20-31(28-26)25-12-5-2-6-13-25)19-29-15-17-30(18-16-29)21-24-11-7-8-14-27-24/h1-14,20H,15-19,21H2 |
| InChIKey | PNGHNPRUKFKOFW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |