About (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate
(4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 16577218) has the molecular formula C17H17Cl3N2O2
and a molecular weight of 387.69 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate.
Molecular Properties
| Compound Name | (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| PubChem CID | 16577218 |
| Molecular Formula | C17H17Cl3N2O2 |
| Molecular Weight | 387.69 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | CC(C)(C)c1ccc(COC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl3N2O2/c1-17(2,3)10-6-4-9(5-7-10)8-24-16(23)14-11(18)13(21)12(19)15(20)22-14/h4-7H,8H2,1-3H3,(H2,21,22) |
| InChIKey | IKPQAMILIYCHNG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?
The IUPAC name of (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate (CID 16577218) is (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate.
What is the SMILES notation for (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?
The canonical SMILES for (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate is CC(C)(C)c1ccc(COC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)cc1.
What is the InChIKey of (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?
The InChIKey is IKPQAMILIYCHNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Cl3N2O2/c1-17(2,3)10-6-4-9(5-7-10)8-24-16(23)14-11(18)13(21)12(19)15(20)22-14/h4-7H,8H2,1-3H3,(H2,21,22).
What are the key properties of (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?
(4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate has a molecular weight of 387.69 g/mol, XLogP of 5.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl)methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate is sourced from PubChem (CID 16577218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).