C18H16F3NO4 — CID 16578596
(4-methoxyphenyl)methyl 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 16578596) has the molecular formula C18H16F3NO4 and a molecular weight of 367.32 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | (4-methoxyphenyl)methyl 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 16578596 |
| Molecular Formula | C18H16F3NO4 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | COc1ccc(COC(=O)CNC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H16F3NO4/c1-25-15-8-2-12(3-9-15)11-26-16(23)10-22-17(24)13-4-6-14(7-5-13)18(19,20)21/h2-9H,10-11H2,1H3,(H,22,24) |
| InChIKey | LXPOEBRUVVBABE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |