About (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate
(4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate (PubChem CID 16578791) has the molecular formula C19H17ClN2O3
and a molecular weight of 356.81 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
| PubChem CID | 16578791 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
| SMILES | COc1ccc(COC(=O)c2c(C)nn(-c3ccccc3)c2Cl)cc1 |
| InChI | InChI=1S/C19H17ClN2O3/c1-13-17(18(20)22(21-13)15-6-4-3-5-7-15)19(23)25-12-14-8-10-16(24-2)11-9-14/h3-11H,12H2,1-2H3 |
| InChIKey | YUISSUSCHQSLLM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate?
The IUPAC name of (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate (CID 16578791) is (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate.
What is the SMILES notation for (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate?
The canonical SMILES for (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate is COc1ccc(COC(=O)c2c(C)nn(-c3ccccc3)c2Cl)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate?
The InChIKey is YUISSUSCHQSLLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN2O3/c1-13-17(18(20)22(21-13)15-6-4-3-5-7-15)19(23)25-12-14-8-10-16(24-2)11-9-14/h3-11H,12H2,1-2H3.
What are the key properties of (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate?
(4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate has a molecular weight of 356.81 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate is sourced from PubChem (CID 16578791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).