About N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide
N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 16579691) has the molecular formula C16H13F3N4O2S2
and a molecular weight of 414.43 g/mol. Its IUPAC name is N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 16579691 |
| Molecular Formula | C16H13F3N4O2S2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cn1cnnc1Sc1ccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H13F3N4O2S2/c1-23-10-20-21-15(23)26-13-7-5-12(6-8-13)22-27(24,25)14-4-2-3-11(9-14)16(17,18)19/h2-10,22H,1H3 |
| InChIKey | VUWBINFYMGLNEG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide (CID 16579691) is N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide is Cn1cnnc1Sc1ccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1.
What is the InChIKey of N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide?
The InChIKey is VUWBINFYMGLNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N4O2S2/c1-23-10-20-21-15(23)26-13-7-5-12(6-8-13)22-27(24,25)14-4-2-3-11(9-14)16(17,18)19/h2-10,22H,1H3.
What are the key properties of N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide?
N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide has a molecular weight of 414.43 g/mol, XLogP of 3.79, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 16579691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).