About 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine
6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine (PubChem CID 16579711) has the molecular formula C14H8ClN5O
and a molecular weight of 297.71 g/mol. Its IUPAC name is 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine.
Molecular Properties
| Compound Name | 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine |
| PubChem CID | 16579711 |
| Molecular Formula | C14H8ClN5O |
| Molecular Weight | 297.71 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine |
| SMILES | Clc1ccc(Oc2ccc3nnnn3n2)c2ccccc12 |
| InChI | InChI=1S/C14H8ClN5O/c15-11-5-6-12(10-4-2-1-3-9(10)11)21-14-8-7-13-16-18-19-20(13)17-14/h1-8H |
| InChIKey | SLWYCYIHQTZEKE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine?
The IUPAC name of 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine (CID 16579711) is 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine.
What is the SMILES notation for 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine?
The canonical SMILES for 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine is Clc1ccc(Oc2ccc3nnnn3n2)c2ccccc12.
What is the InChIKey of 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine?
The InChIKey is SLWYCYIHQTZEKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClN5O/c15-11-5-6-12(10-4-2-1-3-9(10)11)21-14-8-7-13-16-18-19-20(13)17-14/h1-8H.
What are the key properties of 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine?
6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine has a molecular weight of 297.71 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chloronaphthalen-1-yl)oxytetrazolo[1,5-b]pyridazine is sourced from PubChem (CID 16579711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).