About 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide
2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 16580102) has the molecular formula C11H10N2O2S
and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 16580102 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1cnc(NC(=O)c2ccccc2O)s1 |
| InChI | InChI=1S/C11H10N2O2S/c1-7-6-12-11(16-7)13-10(15)8-4-2-3-5-9(8)14/h2-6,14H,1H3,(H,12,13,15) |
| InChIKey | YLTAAMUGGIYNJU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide (CID 16580102) is 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide is Cc1cnc(NC(=O)c2ccccc2O)s1.
What is the InChIKey of 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide?
The InChIKey is YLTAAMUGGIYNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c1-7-6-12-11(16-7)13-10(15)8-4-2-3-5-9(8)14/h2-6,14H,1H3,(H,12,13,15).
What are the key properties of 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide?
2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide has a molecular weight of 234.28 g/mol, XLogP of 2.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 16580102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).