About quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate
quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 16580178) has the molecular formula C24H26N2O4
and a molecular weight of 406.48 g/mol. Its IUPAC name is quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate.
Molecular Properties
| Compound Name | quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate |
| PubChem CID | 16580178 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | CCOc1ccccc1C(=O)N[C@H](C(=O)OCc1cccc2cccnc12)C(C)C |
| InChI | InChI=1S/C24H26N2O4/c1-4-29-20-13-6-5-12-19(20)23(27)26-21(16(2)3)24(28)30-15-18-10-7-9-17-11-8-14-25-22(17)18/h5-14,16,21H,4,15H2,1-3H3,(H,26,27)/t21-/m0/s1 |
| InChIKey | FVYNVTYFEVMZJT-NRFANRHFSA-N |
| XLogP | 4.13 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate?
The IUPAC name of quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate (CID 16580178) is quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate.
What is the SMILES notation for quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate?
The canonical SMILES for quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate is CCOc1ccccc1C(=O)N[C@H](C(=O)OCc1cccc2cccnc12)C(C)C.
What is the InChIKey of quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate?
The InChIKey is FVYNVTYFEVMZJT-NRFANRHFSA-N. The full InChI is InChI=1S/C24H26N2O4/c1-4-29-20-13-6-5-12-19(20)23(27)26-21(16(2)3)24(28)30-15-18-10-7-9-17-11-8-14-25-22(17)18/h5-14,16,21H,4,15H2,1-3H3,(H,26,27)/t21-/m0/s1.
What are the key properties of quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate?
quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate has a molecular weight of 406.48 g/mol, XLogP of 4.13, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-ylmethyl (2S)-2-[(2-ethoxybenzoyl)amino]-3-methylbutanoate is sourced from PubChem (CID 16580178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).