C15H19N5O3S2 — CID 16580464
N-cyclopropyl-N-[5-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 16580464) has the molecular formula C15H19N5O3S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-cyclopropyl-N-[5-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 16580464 |
| Molecular Formula | C15H19N5O3S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-cyclopropyl-N-[5-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)N(c1nnc(SCc2cc(=O)n(C)c(=O)n2C)s1)C1CC1 |
| InChI | InChI=1S/C15H19N5O3S2/c1-4-11(21)20(9-5-6-9)13-16-17-14(25-13)24-8-10-7-12(22)19(3)15(23)18(10)2/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | RMGJIKNKBNQNAV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|