About 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate
2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate (PubChem CID 16580507) has the molecular formula C22H24N2O5
and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate.
Molecular Properties
| Compound Name | 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate |
| PubChem CID | 16580507 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate |
| SMILES | Cc1cc(OCCOC(=O)Cn2c(=O)[nH]c(=O)c3ccccc32)ccc1C(C)C |
| InChI | InChI=1S/C22H24N2O5/c1-14(2)17-9-8-16(12-15(17)3)28-10-11-29-20(25)13-24-19-7-5-4-6-18(19)21(26)23-22(24)27/h4-9,12,14H,10-11,13H2,1-3H3,(H,23,26,27) |
| InChIKey | IVJXFJIFSKTZDV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate?
The IUPAC name of 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate (CID 16580507) is 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate.
What is the SMILES notation for 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate?
The canonical SMILES for 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate is Cc1cc(OCCOC(=O)Cn2c(=O)[nH]c(=O)c3ccccc32)ccc1C(C)C.
What is the InChIKey of 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate?
The InChIKey is IVJXFJIFSKTZDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O5/c1-14(2)17-9-8-16(12-15(17)3)28-10-11-29-20(25)13-24-19-7-5-4-6-18(19)21(26)23-22(24)27/h4-9,12,14H,10-11,13H2,1-3H3,(H,23,26,27).
What are the key properties of 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate?
2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate has a molecular weight of 396.44 g/mol, XLogP of 2.74, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-4-propan-2-ylphenoxy)ethyl 2-(2,4-dioxoquinazolin-1-yl)acetate is sourced from PubChem (CID 16580507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).