C19H21N3O5 — CID 16580576
[1-(4-methylanilino)-1-oxopropan-2-yl] (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate (PubChem CID 16580576) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is [1-(4-methylanilino)-1-oxopropan-2-yl] (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate.
| Compound Name | [1-(4-methylanilino)-1-oxopropan-2-yl] (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 16580576 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [1-(4-methylanilino)-1-oxopropan-2-yl] (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)C(C)OC(=O)/C=C/c2cn(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C19H21N3O5/c1-12-5-8-15(9-6-12)20-17(24)13(2)27-16(23)10-7-14-11-21(3)19(26)22(4)18(14)25/h5-11,13H,1-4H3,(H,20,24)/b10-7+ |
| InChIKey | DARUJVFOPZXREJ-JXMROGBWSA-N |
| XLogP | 0.98 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|