About (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate
(3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 16581609) has the molecular formula C16H14IN3O2
and a molecular weight of 407.21 g/mol. Its IUPAC name is (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate.
Molecular Properties
| Compound Name | (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate |
| PubChem CID | 16581609 |
| Molecular Formula | C16H14IN3O2 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CC(C)n1ncc2cc(C(=O)Oc3cccc(I)c3)cnc21 |
| InChI | InChI=1S/C16H14IN3O2/c1-10(2)20-15-11(9-19-20)6-12(8-18-15)16(21)22-14-5-3-4-13(17)7-14/h3-10H,1-2H3 |
| InChIKey | VITLGSOPARPRGY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
The IUPAC name of (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate (CID 16581609) is (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate.
What is the SMILES notation for (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
The canonical SMILES for (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate is CC(C)n1ncc2cc(C(=O)Oc3cccc(I)c3)cnc21.
What is the InChIKey of (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
The InChIKey is VITLGSOPARPRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14IN3O2/c1-10(2)20-15-11(9-19-20)6-12(8-18-15)16(21)22-14-5-3-4-13(17)7-14/h3-10H,1-2H3.
What are the key properties of (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate?
(3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate has a molecular weight of 407.21 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate is sourced from PubChem (CID 16581609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).