C23H25FN4OS — CID 16581764
2-[(4-fluorophenyl)methylsulfanyl]-N-[4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)phenyl]acetamide (PubChem CID 16581764) has the molecular formula C23H25FN4OS and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-N-[4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)phenyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-[4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 16581764 |
| Molecular Formula | C23H25FN4OS |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-[4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)phenyl]acetamide |
| SMILES | O=C(CSCc1ccc(F)cc1)Nc1ccc(-c2nnc3n2CCCCCC3)cc1 |
| InChI | InChI=1S/C23H25FN4OS/c24-19-10-6-17(7-11-19)15-30-16-22(29)25-20-12-8-18(9-13-20)23-27-26-21-5-3-1-2-4-14-28(21)23/h6-13H,1-5,14-16H2,(H,25,29) |
| InChIKey | WXNNAUJMCGAWRS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |